Products 1086386-05-1
CAS 1086386-05-1 appears in our catalog under these names: 3-(4-Chloro-3-methylphenyl)propanoic acid, 95%, 3-(4-Chloro-3-methylphenyl)propionic acid, 96% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 500mg.
3-(4-chloro-3-methylphenyl)propanoic acid (CAS 1086386-05-1) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 3-(4-chloro-3-methylphenyl)propanoic acid. InChIKey: PCLIPGMIRVJYFB-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 3-(4-chloro-3-methylphenyl)propanoic acid |
| InChIKey | PCLIPGMIRVJYFB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CCC(=O)O)Cl |
Computed by PubChem (NCBI)