Products 1086463-05-9
CAS 1086463-05-9 appears in our catalog under these names: Cannflavin C, Cannaflavin C, Cannaflavin C (DISCONTINUED), ≥98%, ≥98%, Cannflavin C, 90.9%. Offered by: Chemat Brand, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 5mg, 1mg, 10mg, 5 mg, 1 mg.
8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one (CAS 1086463-05-9) is a chemical compound with the molecular formula C26H28O6 and a molecular weight of 436.5 g/mol. IUPAC name: 8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one. InChIKey: PPYVSZXPYMTRKN-LZYBPNLTSA-N.
| Molecular formula | C26H28O6 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | 8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one |
| InChIKey | PPYVSZXPYMTRKN-LZYBPNLTSA-N |
| SMILES | CC(=CCC/C(=C/CC1=C2C(=C(C=C1O)O)C(=O)C=C(O2)C3=CC(=C(C=C3)O)OC)/C)C |
Computed by PubChem (NCBI)