CAS 35780-80-4 appears in our catalog under these names: (2R,3R,4S,5R,6R)-2-Methoxy-6-((trityloxy)methyl)tetrahydro-2H-pyran-3,4,5-triol, 95%, Methyl 6-O-trityl-β-D-galactopyranoside. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 10g, 1g, 2g, 5g.
(2R,3R,4S,5R,6R)-2-methoxy-6-(trityloxymethyl)oxane-3,4,5-triol (CAS 35780-80-4) is a chemical compound with the molecular formula C26H28O6 and a molecular weight of 436.5 g/mol. IUPAC name: (2R,3R,4S,5R,6R)-2-methoxy-6-(trityloxymethyl)oxane-3,4,5-triol. InChIKey: WYAMNJUPQNEGOI-ZLOLNMDISA-N.
| Molecular formula | C26H28O6 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | (2R,3R,4S,5R,6R)-2-methoxy-6-(trityloxymethyl)oxane-3,4,5-triol |
| InChIKey | WYAMNJUPQNEGOI-ZLOLNMDISA-N |
| SMILES | CO[C@H]1[C@@H]([C@H]([C@H]([C@H](O1)COC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)O)O)O |
Computed by PubChem (NCBI)