CAS 1087160-40-4 appears in our catalog under these names: Piperidine-4-boronic acid pinacol ester, 96%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 10g, 5g, 1g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine (CAS 1087160-40-4) is a chemical compound with the molecular formula C11H22BNO2 and a molecular weight of 211.11 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine. InChIKey: ITJOVDVQZDQJDF-UHFFFAOYSA-N.
| Molecular formula | C11H22BNO2 |
|---|---|
| Molecular weight | 211.11 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine |
| InChIKey | ITJOVDVQZDQJDF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCNCC2 |
Computed by PubChem (NCBI)