CAS 2365173-92-6 is the registry number for 3-((4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyrrolidine (CAS 2365173-92-6) is a chemical compound with the molecular formula C11H22BNO2 and a molecular weight of 211.11 g/mol. IUPAC name: 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyrrolidine. InChIKey: PWQRLJLPEWSJSZ-UHFFFAOYSA-N.
| Molecular formula | C11H22BNO2 |
|---|---|
| Molecular weight | 211.11 g/mol |
| IUPAC name | 3-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]pyrrolidine |
| InChIKey | PWQRLJLPEWSJSZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2CCNC2 |
Computed by PubChem (NCBI)