CAS 108722-46-9 appears in our catalog under these names: 4-Bromo-1,2,3,5,6,7-hexahydro-S-indacene, 4-Bromo-1,2,3,5,6,7-hexahydro-s-indacene 97%, 4-Bromo-1,2,3,5,6,7-hexahydro-s-indacene, 97%, 97%, 4-Bromo-1,2,3,5,6,7-hexahydro-s-indacene, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
4-bromo-1,2,3,5,6,7-hexahydro-s-indacene (CAS 108722-46-9) is a chemical compound with the molecular formula C12H13Br and a molecular weight of 237.13 g/mol. IUPAC name: 4-bromo-1,2,3,5,6,7-hexahydro-s-indacene. InChIKey: JXUDTIMNBBRXGB-UHFFFAOYSA-N.
| Molecular formula | C12H13Br |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 4-bromo-1,2,3,5,6,7-hexahydro-s-indacene |
| InChIKey | JXUDTIMNBBRXGB-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(CCC3)C(=C2C1)Br |
Computed by PubChem (NCBI)