CAS 1605-17-0 appears in our catalog under these names: 1-Bromo-4-(cyclohex-1-en-1-yl)benzene, 97%, 4'-Bromo-2,3,4,5-tetrahydro-1,1'-biphenyl, 97%, 1-Bromo-4-cyclohex-1-en-1-ylbenzene. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 25g, 5g.
1-bromo-4-(cyclohexen-1-yl)benzene (CAS 1605-17-0) is a chemical compound with the molecular formula C12H13Br and a molecular weight of 237.13 g/mol. IUPAC name: 1-bromo-4-(cyclohexen-1-yl)benzene. InChIKey: ISODRHQFKANYIX-UHFFFAOYSA-N.
| Molecular formula | C12H13Br |
|---|---|
| Molecular weight | 237.13 g/mol |
| IUPAC name | 1-bromo-4-(cyclohexen-1-yl)benzene |
| InChIKey | ISODRHQFKANYIX-UHFFFAOYSA-N |
| SMILES | C1CCC(=CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)