CAS 108740-74-5 appears in our catalog under these names: (2S,3S,4R,5R,6S)-2-Methyl-6-(phenylthio)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 97%, Phenyl 2,3,4-tri-O-acetyl-a-L-thiorhamnopyranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 500mg, 250mg.
[(2S,3S,4R,5R,6S)-4,5-diacetyloxy-2-methyl-6-phenylsulfanyloxan-3-yl] acetate (CAS 108740-74-5) is a chemical compound with the molecular formula C18H22O7S and a molecular weight of 382.4 g/mol. IUPAC name: [(2S,3S,4R,5R,6S)-4,5-diacetyloxy-2-methyl-6-phenylsulfanyloxan-3-yl] acetate. InChIKey: YPJGKQRQWRZEKO-VVRBALCJSA-N.
| Molecular formula | C18H22O7S |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | [(2S,3S,4R,5R,6S)-4,5-diacetyloxy-2-methyl-6-phenylsulfanyloxan-3-yl] acetate |
| InChIKey | YPJGKQRQWRZEKO-VVRBALCJSA-N |
| SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)SC2=CC=CC=C2)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)