CAS 61025-08-9 appears in our catalog under these names: 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside, 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside, 98%, 98%, 4-Methylphenyl 2,3,4-tri-O-acetyl-1-thio-β-D-xylopyranoside, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 10g, 1g, 2g, 5g, 100mg, 250mg.
[(3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-methylphenyl)sulfanyloxan-3-yl] acetate (CAS 61025-08-9) is a chemical compound with the molecular formula C18H22O7S and a molecular weight of 382.4 g/mol. IUPAC name: [(3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-methylphenyl)sulfanyloxan-3-yl] acetate. InChIKey: DGABBMAEOQOJPG-XDNAFOTISA-N.
| Molecular formula | C18H22O7S |
|---|---|
| Molecular weight | 382.4 g/mol |
| IUPAC name | [(3R,4S,5R,6S)-4,5-diacetyloxy-6-(4-methylphenyl)sulfanyloxan-3-yl] acetate |
| InChIKey | DGABBMAEOQOJPG-XDNAFOTISA-N |
| SMILES | CC1=CC=C(C=C1)S[C@H]2[C@@H]([C@H]([C@@H](CO2)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)