Products 1087646-28-3
CAS 1087646-28-3 is the registry number for N-(2-Hydroxypropyl)-2-methyl-5-nitrobenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-hydroxypropyl)-2-methyl-5-nitrobenzenesulfonamide (CAS 1087646-28-3) is a chemical compound with the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. IUPAC name: N-(2-hydroxypropyl)-2-methyl-5-nitrobenzenesulfonamide. InChIKey: LWVZLDSJFAGACL-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O5S |
|---|---|
| Molecular weight | 274.30 g/mol |
| IUPAC name | N-(2-hydroxypropyl)-2-methyl-5-nitrobenzenesulfonamide |
| InChIKey | LWVZLDSJFAGACL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)NCC(C)O |
Computed by PubChem (NCBI)