CAS 1457138-78-1 is the registry number for N-Isopropyl-2-methoxy-5-nitrobenzenesulfonamide, 93%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-methoxy-5-nitro-N-propan-2-ylbenzenesulfonamide (CAS 1457138-78-1) is a chemical compound with the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. IUPAC name: 2-methoxy-5-nitro-N-propan-2-ylbenzenesulfonamide. InChIKey: DJVOBSOAHSUGEY-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O5S |
|---|---|
| Molecular weight | 274.30 g/mol |
| IUPAC name | 2-methoxy-5-nitro-N-propan-2-ylbenzenesulfonamide |
| InChIKey | DJVOBSOAHSUGEY-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=C(C=CC(=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)