CAS 1087784-42-6 is the registry number for 4-(3-Nitrobenzenesulfonyl)piperazin-2-one, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-(3-nitrophenyl)sulfonylpiperazin-2-one (CAS 1087784-42-6) is a chemical compound with the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. IUPAC name: 4-(3-nitrophenyl)sulfonylpiperazin-2-one. InChIKey: OUPIGHVJMVXBJQ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O5S |
|---|---|
| Molecular weight | 285.28 g/mol |
| IUPAC name | 4-(3-nitrophenyl)sulfonylpiperazin-2-one |
| InChIKey | OUPIGHVJMVXBJQ-UHFFFAOYSA-N |
| SMILES | C1CN(CC(=O)N1)S(=O)(=O)C2=CC=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)