CAS 951787-74-9 is the registry number for (S) Nifuratel. Offered by: TRC. Available pack sizes: 500mg.
(5S)-5-(methylsulfanylmethyl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one (CAS 951787-74-9) is a chemical compound with the molecular formula C10H11N3O5S and a molecular weight of 285.28 g/mol. IUPAC name: (5S)-5-(methylsulfanylmethyl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one. InChIKey: SRQKTCXJCCHINN-TYXSZMRMSA-N.
| Molecular formula | C10H11N3O5S |
|---|---|
| Molecular weight | 285.28 g/mol |
| IUPAC name | (5S)-5-(methylsulfanylmethyl)-3-[(E)-(5-nitrofuran-2-yl)methylideneamino]-1,3-oxazolidin-2-one |
| InChIKey | SRQKTCXJCCHINN-TYXSZMRMSA-N |
| SMILES | CSC[C@@H]1CN(C(=O)O1)/N=C/C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)