CAS 1087784-67-5 appears in our catalog under these names: N-{(4-(furan-2-amido)phenyl)methyl}-1H-imidazole-1-carboxamide, 95%, N-{(4-(Furan-2-amido)phenyl)methyl}-1H-imidazole-1-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
N-[[4-(furan-2-carbonylamino)phenyl]methyl]imidazole-1-carboxamide (CAS 1087784-67-5) is a chemical compound with the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. IUPAC name: N-[[4-(furan-2-carbonylamino)phenyl]methyl]imidazole-1-carboxamide. InChIKey: XVAKLCPCYVDASS-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O3 |
|---|---|
| Molecular weight | 310.31 g/mol |
| IUPAC name | N-[[4-(furan-2-carbonylamino)phenyl]methyl]imidazole-1-carboxamide |
| InChIKey | XVAKLCPCYVDASS-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)NC2=CC=C(C=C2)CNC(=O)N3C=CN=C3 |
Computed by PubChem (NCBI)