Products 2640292-28-8
CAS 2640292-28-8 is the registry number for Olaparib Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydrazinyl-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid (CAS 2640292-28-8) is a chemical compound with the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. IUPAC name: 2-hydrazinyl-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid. InChIKey: YFBPYZNWKOIUFF-UHFFFAOYSA-N.
| Molecular formula | C16H14N4O3 |
|---|---|
| Molecular weight | 310.31 g/mol |
| IUPAC name | 2-hydrazinyl-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid |
| InChIKey | YFBPYZNWKOIUFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC(=C(C=C3)NN)C(=O)O |
Computed by PubChem (NCBI)