CAS 1087788-81-5 appears in our catalog under these names: 2,2,2-Trifluoroethyl N-(2,4,6-trimethylphenyl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(2,4,6-trimethylphenyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2,2,2-trifluoroethyl N-(2,4,6-trimethylphenyl)carbamate (CAS 1087788-81-5) is a chemical compound with the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2,4,6-trimethylphenyl)carbamate. InChIKey: BAXPBBVKZUIZRF-UHFFFAOYSA-N.
| Molecular formula | C12H14F3NO2 |
|---|---|
| Molecular weight | 261.24 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(2,4,6-trimethylphenyl)carbamate |
| InChIKey | BAXPBBVKZUIZRF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC(=O)OCC(F)(F)F)C |
Computed by PubChem (NCBI)