CAS 1088-79-5 is the registry number for rac-meta-Melphalan. Offered by: TRC. Available pack sizes: 1g.
2-amino-3-[3-[bis(2-chloroethyl)amino]phenyl]propanoic acid (CAS 1088-79-5) is a chemical compound with the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. IUPAC name: 2-amino-3-[3-[bis(2-chloroethyl)amino]phenyl]propanoic acid. InChIKey: QDGAVODICPCDMU-UHFFFAOYSA-N.
| Molecular formula | C13H18Cl2N2O2 |
|---|---|
| Molecular weight | 305.20 g/mol |
| IUPAC name | 2-amino-3-[3-[bis(2-chloroethyl)amino]phenyl]propanoic acid |
| InChIKey | QDGAVODICPCDMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N(CCCl)CCCl)CC(C(=O)O)N |
Computed by PubChem (NCBI)