CAS 1088-80-8 appears in our catalog under these names: Melphalan Impurity 14, Metamelfalan, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-[3-[bis(2-chloroethyl)amino]phenyl]propanoic acid (CAS 1088-80-8) is a chemical compound with the molecular formula C13H18Cl2N2O2 and a molecular weight of 305.20 g/mol. IUPAC name: (2S)-2-amino-3-[3-[bis(2-chloroethyl)amino]phenyl]propanoic acid. InChIKey: QDGAVODICPCDMU-LBPRGKRZSA-N.
| Molecular formula | C13H18Cl2N2O2 |
|---|---|
| Molecular weight | 305.20 g/mol |
| IUPAC name | (2S)-2-amino-3-[3-[bis(2-chloroethyl)amino]phenyl]propanoic acid |
| InChIKey | QDGAVODICPCDMU-LBPRGKRZSA-N |
| SMILES | C1=CC(=CC(=C1)N(CCCl)CCCl)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)