CAS 108825-05-4 appears in our catalog under these names: Clemastine EP Impurity A (Mixture of Diastereomers), Clemastine Impurity 1（EP Impurity A）, Clemastine EP Impurity A, Clemastine Fumarate EP Impurity A, (2R)-2-(2-((R)-1-(4-Chlorophenyl)-1-phenylethoxy)ethyl)-1-methylpyrrolidine 1-oxide, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methyl-1-oxidopyrrolidin-1-ium (CAS 108825-05-4) is a chemical compound with the molecular formula C21H26ClNO2 and a molecular weight of 359.9 g/mol. IUPAC name: (2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methyl-1-oxidopyrrolidin-1-ium. InChIKey: PRZFEDGPQDFPLM-OJOWTSHBSA-N.
| Molecular formula | C21H26ClNO2 |
|---|---|
| Molecular weight | 359.9 g/mol |
| IUPAC name | (2R)-2-[2-[(1R)-1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methyl-1-oxidopyrrolidin-1-ium |
| InChIKey | PRZFEDGPQDFPLM-OJOWTSHBSA-N |
| SMILES | C[C@@](C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)OCC[C@H]3CCC[N+]3(C)[O-] |
Computed by PubChem (NCBI)