Products 860229-23-8

CAS 860229-23-8 is the registry number for MCV 4527 Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.

Structural formula: {0} (CAS {1})

[4-phenyl-1-(2-phenylethyl)piperidin-4-yl] acetate;hydrochloride (CAS 860229-23-8) is a chemical compound with the molecular formula C21H26ClNO2 and a molecular weight of 359.9 g/mol. IUPAC name: [4-phenyl-1-(2-phenylethyl)piperidin-4-yl] acetate;hydrochloride. InChIKey: WQUUPFMHEQIXIV-UHFFFAOYSA-N.

Identity
Molecular formulaC21H26ClNO2
Molecular weight359.9 g/mol
IUPAC name[4-phenyl-1-(2-phenylethyl)piperidin-4-yl] acetate;hydrochloride
InChIKeyWQUUPFMHEQIXIV-UHFFFAOYSA-N
SMILESCC(=O)OC1(CCN(CC1)CCC2=CC=CC=C2)C3=CC=CC=C3.Cl

Computed by PubChem (NCBI)