Products 108847-20-7
CAS 108847-20-7 appears in our catalog under these names: Dibenzo(b,d)thiophene-4-boronic acid, Dibenzothiophene-4-boronic acid/ 95+%, Dibenzothiophene–4–boronic acid, Dibenzothiophene-4-boronic acid, 95% , Dibenzothiophene-4-boronic Acid (contains varying amounts of Anhydride). Offered by: TRC, Chemat, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100mg, 250mg, 500mg, 1g, 25g, 5g, 10g, 100g.
Dibenzothiophen-4-ylboronic acid (CAS 108847-20-7) is a chemical compound with the molecular formula C12H9BO2S and a molecular weight of 228.08 g/mol. IUPAC name: dibenzothiophen-4-ylboronic acid. InChIKey: GOXNHPQCCUVWRO-UHFFFAOYSA-N.
| Molecular formula | C12H9BO2S |
|---|---|
| Molecular weight | 228.08 g/mol |
| IUPAC name | dibenzothiophen-4-ylboronic acid |
| InChIKey | GOXNHPQCCUVWRO-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C3=CC=CC=C3S2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
Dibenzothiophene-4-boronic acid, 4-Dibenzothiopheneboronic acid, 4-Dibenzothienylboronic acid, dibenzo[b,d]thiophen-4-ylboronic acid, Dibenzothiophen-4-ylboronic Acid, Dibenzo[b,d]thiophene-4-boronic acid, Boronic acid, 4-dibenzothienyl-, Dibenzothiophene-4-boronic Acid (contains varying amounts of Anhydride), dibenzo{b,d}thiophen-4-ylboronic acid, 4-Dibenzothiopheneboronicacid