Products 668983-97-9
CAS 668983-97-9 appears in our catalog under these names: Dibenzo[b,d]thiophen-2-ylboronic acid 97%, Dibenzo[b,d]thiophen-2-ylboronic acid, 97%, Dibenzothiophene-2-boronic acid, Dibenzothiophene–2–boronic Acid(contains varying amounts of Anhydride), Dibenzothiophene-2-boronic Acid (contains varying amounts of Anhydride). Offered by: Ambeed, BLDpharm, TRC, GLPBio, TCI. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg, 500mg.
Dibenzothiophen-2-ylboronic acid (CAS 668983-97-9) is a chemical compound with the molecular formula C12H9BO2S and a molecular weight of 228.08 g/mol. IUPAC name: dibenzothiophen-2-ylboronic acid. InChIKey: CSLSCVHILGCSTE-UHFFFAOYSA-N.
| Molecular formula | C12H9BO2S |
|---|---|
| Molecular weight | 228.08 g/mol |
| IUPAC name | dibenzothiophen-2-ylboronic acid |
| InChIKey | CSLSCVHILGCSTE-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)SC3=CC=CC=C32)(O)O |
Computed by PubChem (NCBI)
Synonyms:
dibenzo[b,d]thiophen-2-ylboronic acid, Dibenzothiophen-2-ylboronic Acid, Boronic acid, B-2-dibenzothienyl-, Boronic acid,B-2-ibenzothienyl-, dibenzo[b,d]thiophen-2-yl boronic acid, Dibenzo[b,d]thiophen-2-ylboronic acid (contains varying amounts of Anhydride), Dibenzothiophene-2-boronic Acid(contains varying amounts of Anhydride), Boronic acid, 2-dibenzothienyl-, Dibenzothiophen-2-yl-dihydroxy-borane, 2-dibenzothienylboronic acid