Products 108904-24-1

CAS 108904-24-1 is the registry number for 6-(6-Aminohexanamido)-hexanoic Acid Methyl Ester Hydrochloride. Offered by: TRC. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Methyl 6-(6-aminohexanoylamino)hexanoate;hydrochloride (CAS 108904-24-1) is a chemical compound with the molecular formula C13H27ClN2O3 and a molecular weight of 294.82 g/mol. IUPAC name: methyl 6-(6-aminohexanoylamino)hexanoate;hydrochloride. InChIKey: CLTQTDWGHJFMPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H27ClN2O3
Molecular weight294.82 g/mol
IUPAC namemethyl 6-(6-aminohexanoylamino)hexanoate;hydrochloride
InChIKeyCLTQTDWGHJFMPZ-UHFFFAOYSA-N
SMILESCOC(=O)CCCCCNC(=O)CCCCCN.Cl

Computed by PubChem (NCBI)