Products 6491-83-4
CAS 6491-83-4 appears in our catalog under these names: H-Leu-leu-OMe hydrochloride, 97%, H-Leu-leu-OMe hydrochloride, L–Leucyl–L–Leucine methyl ester (hydrochloride), L-Leucyl-L-Leucine methyl ester hydrochloride/ 99.3% (existing batch purity), Leu-Leu-OMe·HCl. Offered by: Combi-blocks, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 1g, 25g, 100g, 5g, 2,5g, 100mg, 250mg, 10g.
Methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate;hydrochloride (CAS 6491-83-4) is a chemical compound with the molecular formula C13H27ClN2O3 and a molecular weight of 294.82 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate;hydrochloride. InChIKey: RVXQFTNCULOWRV-ACMTZBLWSA-N.
| Molecular formula | C13H27ClN2O3 |
|---|---|
| Molecular weight | 294.82 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-amino-4-methylpentanoyl]amino]-4-methylpentanoate;hydrochloride |
| InChIKey | RVXQFTNCULOWRV-ACMTZBLWSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl leucylleucinate hydrochloride, H-Leu-Leu-Ome.HCl, H-LEU-LEU-OME HCL, H-Leu-leu-OMe hydrochloride, Leu-Leu-ome HCl, L-Leucine, L-leucyl-, methyl ester, monohydrochloride, Leu-Leu-ome hydrochloride, L-Leucyl-L-Leucine methyl ester (hydrochloride), methyl L-leucyl-L-leucinate hydrochloride, L-Leucyl-L-leucine Methyl Ester HCl