Products 1089189-34-3

CAS 1089189-34-3 is the registry number for (2'-Bromo-[1,1'-biphenyl]-2-yl)boronic acid, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

[2-(2-bromophenyl)phenyl]boronic acid (CAS 1089189-34-3) is a chemical compound with the molecular formula C12H10BBrO2 and a molecular weight of 276.92 g/mol. IUPAC name: [2-(2-bromophenyl)phenyl]boronic acid. InChIKey: BXYVFENPSFGAIM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BBrO2
Molecular weight276.92 g/mol
IUPAC name[2-(2-bromophenyl)phenyl]boronic acid
InChIKeyBXYVFENPSFGAIM-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1C2=CC=CC=C2Br)(O)O

Computed by PubChem (NCBI)