CAS 1089189-34-3 is the registry number for (2'-Bromo-[1,1'-biphenyl]-2-yl)boronic acid, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
[2-(2-bromophenyl)phenyl]boronic acid (CAS 1089189-34-3) is a chemical compound with the molecular formula C12H10BBrO2 and a molecular weight of 276.92 g/mol. IUPAC name: [2-(2-bromophenyl)phenyl]boronic acid. InChIKey: BXYVFENPSFGAIM-UHFFFAOYSA-N.
| Molecular formula | C12H10BBrO2 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | [2-(2-bromophenyl)phenyl]boronic acid |
| InChIKey | BXYVFENPSFGAIM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C2=CC=CC=C2Br)(O)O |
Computed by PubChem (NCBI)