CAS 2081938-84-1 is the registry number for (5-bromo-[1,1'-biphenyl]-3-yl)boronic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(3-bromo-5-phenylphenyl)boronic acid (CAS 2081938-84-1) is a chemical compound with the molecular formula C12H10BBrO2 and a molecular weight of 276.92 g/mol. IUPAC name: (3-bromo-5-phenylphenyl)boronic acid. InChIKey: LUJLLIDAMALCJP-UHFFFAOYSA-N.
| Molecular formula | C12H10BBrO2 |
|---|---|
| Molecular weight | 276.92 g/mol |
| IUPAC name | (3-bromo-5-phenylphenyl)boronic acid |
| InChIKey | LUJLLIDAMALCJP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)