Products 1089280-09-0
CAS 1089280-09-0 is the registry number for (R)-N,4-Dibenzyl-5-oxomorpholine-3-carboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3R)-N,4-dibenzyl-5-oxomorpholine-3-carboxamide (CAS 1089280-09-0) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: (3R)-N,4-dibenzyl-5-oxomorpholine-3-carboxamide. InChIKey: VJEJAZFLOOOCJU-QGZVFWFLSA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (3R)-N,4-dibenzyl-5-oxomorpholine-3-carboxamide |
| InChIKey | VJEJAZFLOOOCJU-QGZVFWFLSA-N |
| SMILES | C1[C@@H](N(C(=O)CO1)CC2=CC=CC=C2)C(=O)NCC3=CC=CC=C3 |
Computed by PubChem (NCBI)