CAS 1089280-14-7 appears in our catalog under these names: (S)-Octahydropyrazino[2,1-c][1,4]oxazine dihydrochloride 98%, (S)-Octahydropyrazino[2,1-c][1,4]oxazine Dihydrochloride, 97%, 97%, (S)-Octahydropyrazino[2,1-c][1,4]oxazine dihydrochloride, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 10g, 25g.
(9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine;dihydrochloride (CAS 1089280-14-7) is a chemical compound with the molecular formula C7H16Cl2N2O and a molecular weight of 215.12 g/mol. IUPAC name: (9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine;dihydrochloride. InChIKey: NTFPIALZQJURCZ-KLXURFKVSA-N.
| Molecular formula | C7H16Cl2N2O |
|---|---|
| Molecular weight | 215.12 g/mol |
| IUPAC name | (9aS)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazine;dihydrochloride |
| InChIKey | NTFPIALZQJURCZ-KLXURFKVSA-N |
| SMILES | C1CN2CCOC[C@@H]2CN1.Cl.Cl |
Computed by PubChem (NCBI)