CAS 2197434-15-2 is the registry number for (R)-N-(Oxetan-3-yl)pyrrolidin-3-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-N-(oxetan-3-yl)pyrrolidin-3-amine;dihydrochloride (CAS 2197434-15-2) is a chemical compound with the molecular formula C7H16Cl2N2O and a molecular weight of 215.12 g/mol. IUPAC name: (3R)-N-(oxetan-3-yl)pyrrolidin-3-amine;dihydrochloride. InChIKey: SRXREQMOSFRTNI-QYCVXMPOSA-N.
| Molecular formula | C7H16Cl2N2O |
|---|---|
| Molecular weight | 215.12 g/mol |
| IUPAC name | (3R)-N-(oxetan-3-yl)pyrrolidin-3-amine;dihydrochloride |
| InChIKey | SRXREQMOSFRTNI-QYCVXMPOSA-N |
| SMILES | C1CNC[C@@H]1NC2COC2.Cl.Cl |
Computed by PubChem (NCBI)