Products 108944-67-8
CAS 108944-67-8 is the registry number for Neocurdione. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,6Z,10S)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione (CAS 108944-67-8) is a chemical compound with the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. IUPAC name: (3R,6Z,10S)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione. InChIKey: KDPFMRXIVDLQKX-BLJGWETHSA-N.
| Molecular formula | C15H24O2 |
|---|---|
| Molecular weight | 236.35 g/mol |
| IUPAC name | (3R,6Z,10S)-6,10-dimethyl-3-propan-2-ylcyclodec-6-ene-1,4-dione |
| InChIKey | KDPFMRXIVDLQKX-BLJGWETHSA-N |
| SMILES | C[C@H]1CC/C=C(\CC(=O)[C@H](CC1=O)C(C)C)/C |
Computed by PubChem (NCBI)