Products 108956-88-3
CAS 108956-88-3 is the registry number for Salbutamol Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzoic acid (CAS 108956-88-3) is a chemical compound with the molecular formula C13H19NO4 and a molecular weight of 253.29 g/mol. IUPAC name: 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzoic acid. InChIKey: KHMZXXLVFHYJFH-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzoic acid |
| InChIKey | KHMZXXLVFHYJFH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)C(=O)O)O |
Computed by PubChem (NCBI)