CAS 108957-20-6 appears in our catalog under these names: N-Boc-3-iodo-L-alanine benzyl ester, 97%, Benzyl (R)–2–((tert–butoxycarbonyl)amino)–3–iodopropanoate, N-Boc-3-Iodo-L-alanine benzyl ester, Boc-3-I-Ala-OH 97%, (R)-Benzyl 2-((tert-butoxycarbonyl)amino)-3-iodopropanoate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g.
Benzyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 108957-20-6) is a chemical compound with the molecular formula C15H20INO4 and a molecular weight of 405.23 g/mol. IUPAC name: benzyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: DDXFSYLOWHQCEK-LBPRGKRZSA-N.
| Molecular formula | C15H20INO4 |
|---|---|
| Molecular weight | 405.23 g/mol |
| IUPAC name | benzyl (2R)-3-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | DDXFSYLOWHQCEK-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CI)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)