CAS 269396-71-6 appears in our catalog under these names: Boc-(r)-3-amino-4-(4-iodo-phenyl)-butyric acid, 95%, (R)–3–((tert–Butoxycarbonyl)amino)–4–(4–iodophenyl)butanoic acid, Boc-(R)-3-Amino-4-(4-iodo-phenyl)-butyric acid, 95%, 95%, (R)-3-((tert-Butoxycarbonyl)amino)-4-(4-iodophenyl)butanoic acid, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
(3R)-4-(4-iodophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 269396-71-6) is a chemical compound with the molecular formula C15H20INO4 and a molecular weight of 405.23 g/mol. IUPAC name: (3R)-4-(4-iodophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: QEKSTALXWONXOD-GFCCVEGCSA-N.
| Molecular formula | C15H20INO4 |
|---|---|
| Molecular weight | 405.23 g/mol |
| IUPAC name | (3R)-4-(4-iodophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | QEKSTALXWONXOD-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)I)CC(=O)O |
Computed by PubChem (NCBI)