CAS 1089674-35-0 is the registry number for L-Phenylephrine-d5. Offered by: TRC. Available pack sizes: 25mg.
3-[(1R)-2,2-dideuterio-1-hydroxy-2-(trideuteriomethylamino)ethyl]phenol (CAS 1089674-35-0) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 172.24 g/mol. IUPAC name: 3-[(1R)-2,2-dideuterio-1-hydroxy-2-(trideuteriomethylamino)ethyl]phenol. InChIKey: SONNWYBIRXJNDC-WHPHVCHMSA-N.
| Molecular formula | C9H13NO2 |
|---|---|
| Molecular weight | 172.24 g/mol |
| IUPAC name | 3-[(1R)-2,2-dideuterio-1-hydroxy-2-(trideuteriomethylamino)ethyl]phenol |
| InChIKey | SONNWYBIRXJNDC-WHPHVCHMSA-N |
| SMILES | [2H]C([2H])([2H])NC([2H])([2H])[C@@H](C1=CC(=CC=C1)O)O |
Computed by PubChem (NCBI)