Products 1276732-88-7
CAS 1276732-88-7 is the registry number for Phenylephrine-D3. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-trideuterio-3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol (CAS 1276732-88-7) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 170.22 g/mol. IUPAC name: 2,4,6-trideuterio-3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol. InChIKey: SONNWYBIRXJNDC-RTUULQMYSA-N.
| Molecular formula | C9H13NO2 |
|---|---|
| Molecular weight | 170.22 g/mol |
| IUPAC name | 2,4,6-trideuterio-3-[(1R)-1-hydroxy-2-(methylamino)ethyl]phenol |
| InChIKey | SONNWYBIRXJNDC-RTUULQMYSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1[C@H](CNC)O)[2H])O)[2H] |
Computed by PubChem (NCBI)