CAS 1089729-72-5 is the registry number for (R)-tert-Butyl 2-carbamothioylpiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Tert-butyl (2R)-2-carbamothioylpiperidine-1-carboxylate (CAS 1089729-72-5) is a chemical compound with the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. IUPAC name: tert-butyl (2R)-2-carbamothioylpiperidine-1-carboxylate. InChIKey: OLZRMIGDZLTJLM-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O2S |
|---|---|
| Molecular weight | 244.36 g/mol |
| IUPAC name | tert-butyl (2R)-2-carbamothioylpiperidine-1-carboxylate |
| InChIKey | OLZRMIGDZLTJLM-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@H]1C(=S)N |
Computed by PubChem (NCBI)