CAS 1934265-93-6 is the registry number for tert-Butyl 7-amino-5-thia-2-azaspiro(3.4)octane-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 7-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate (CAS 1934265-93-6) is a chemical compound with the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. IUPAC name: tert-butyl 7-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate. InChIKey: NLXUFFJGHBSUJP-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O2S |
|---|---|
| Molecular weight | 244.36 g/mol |
| IUPAC name | tert-butyl 7-amino-5-thia-2-azaspiro[3.4]octane-2-carboxylate |
| InChIKey | NLXUFFJGHBSUJP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(CS2)N |
Computed by PubChem (NCBI)