CAS 1089997-40-9 is the registry number for 4-Oxo-N-(2-phenoxyphenyl)-3,4-dihydrophthalazine-1-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-oxo-N-(2-phenoxyphenyl)-3H-phthalazine-1-carboxamide (CAS 1089997-40-9) is a chemical compound with the molecular formula C21H15N3O3 and a molecular weight of 357.4 g/mol. IUPAC name: 4-oxo-N-(2-phenoxyphenyl)-3H-phthalazine-1-carboxamide. InChIKey: UEQDOULOSKFBEZ-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O3 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 4-oxo-N-(2-phenoxyphenyl)-3H-phthalazine-1-carboxamide |
| InChIKey | UEQDOULOSKFBEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC=C2NC(=O)C3=NNC(=O)C4=CC=CC=C43 |
Computed by PubChem (NCBI)