CAS 1919-48-8 appears in our catalog under these names: 2,4,6-Triphenoxy-1,3,5-triazine, 95%, 2,4,6–Triphenoxy–1,3,5–triazine, 2,4,6-Triphenoxy-1,3,5-triazine, 96% , 2,4,6-TRIPHENOXY-1,3,5-TRIAZINE, 98%, 2,4,6-Triphenoxy-1,3,5-triazine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 50g, 100g.
2,4,6-triphenoxy-1,3,5-triazine (CAS 1919-48-8) is a chemical compound with the molecular formula C21H15N3O3 and a molecular weight of 357.4 g/mol. IUPAC name: 2,4,6-triphenoxy-1,3,5-triazine. InChIKey: IYDYVVVAQKFGBS-UHFFFAOYSA-N.
| Molecular formula | C21H15N3O3 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | 2,4,6-triphenoxy-1,3,5-triazine |
| InChIKey | IYDYVVVAQKFGBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC(=NC(=N2)OC3=CC=CC=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)