CAS 109002-61-1 is the registry number for 6-Chloro-n,n'-bis(3-methoxyphenyl)-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-2-N,4-N-bis(3-methoxyphenyl)-1,3,5-triazine-2,4-diamine (CAS 109002-61-1) is a chemical compound with the molecular formula C17H16ClN5O2 and a molecular weight of 357.8 g/mol. IUPAC name: 6-chloro-2-N,4-N-bis(3-methoxyphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: LAQNMYVFOLRIDQ-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN5O2 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 6-chloro-2-N,4-N-bis(3-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | LAQNMYVFOLRIDQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NC2=NC(=NC(=N2)Cl)NC3=CC(=CC=C3)OC |
Computed by PubChem (NCBI)