Products 925200-00-6
CAS 925200-00-6 is the registry number for ZINC09875266. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(5-chloro-2-methoxyphenyl)-3-[4-(1,2,4-triazol-1-ylmethyl)phenyl]urea (CAS 925200-00-6) is a chemical compound with the molecular formula C17H16ClN5O2 and a molecular weight of 357.8 g/mol. IUPAC name: 1-(5-chloro-2-methoxyphenyl)-3-[4-(1,2,4-triazol-1-ylmethyl)phenyl]urea. InChIKey: HGWOFAWMISAEKD-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN5O2 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 1-(5-chloro-2-methoxyphenyl)-3-[4-(1,2,4-triazol-1-ylmethyl)phenyl]urea |
| InChIKey | HGWOFAWMISAEKD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Cl)NC(=O)NC2=CC=C(C=C2)CN3C=NC=N3 |
Computed by PubChem (NCBI)