CAS 109018-78-2 is the registry number for 4-(Chloromethyl)-6-(2,3-dihydro-1h-indol-1-yl)-1,3,5-triazin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(chloromethyl)-6-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-amine (CAS 109018-78-2) is a chemical compound with the molecular formula C12H12ClN5 and a molecular weight of 261.71 g/mol. IUPAC name: 4-(chloromethyl)-6-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-amine. InChIKey: VZHSHXQDBWPZIK-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN5 |
|---|---|
| Molecular weight | 261.71 g/mol |
| IUPAC name | 4-(chloromethyl)-6-(2,3-dihydroindol-1-yl)-1,3,5-triazin-2-amine |
| InChIKey | VZHSHXQDBWPZIK-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C3=NC(=NC(=N3)N)CCl |
Computed by PubChem (NCBI)