CAS 1426290-80-3 is the registry number for (1-(Naphthalen-1-yl)-1H-1,2,3,4-tetrazol-5-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1-naphthalen-1-yltetrazol-5-yl)methanamine;hydrochloride (CAS 1426290-80-3) is a chemical compound with the molecular formula C12H12ClN5 and a molecular weight of 261.71 g/mol. IUPAC name: (1-naphthalen-1-yltetrazol-5-yl)methanamine;hydrochloride. InChIKey: JGKKTHVTCFMXFN-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN5 |
|---|---|
| Molecular weight | 261.71 g/mol |
| IUPAC name | (1-naphthalen-1-yltetrazol-5-yl)methanamine;hydrochloride |
| InChIKey | JGKKTHVTCFMXFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N3C(=NN=N3)CN.Cl |
Computed by PubChem (NCBI)