CAS 109029-96-1 appears in our catalog under these names: 2-Chloro-5-(morpholine-4-sulfonyl)-benzoic acid, 95%, 2-Chloro-5-(morpholinosulfonyl)benzoic acid, 97%, 2-Chloro-5-(morpholinosulfonyl)benzoic acid, 95%, 95%, 2-Chloro-5-(morpholine-4-sulfonyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
2-chloro-5-morpholin-4-ylsulfonylbenzoic acid (CAS 109029-96-1) is a chemical compound with the molecular formula C11H12ClNO5S and a molecular weight of 305.74 g/mol. IUPAC name: 2-chloro-5-morpholin-4-ylsulfonylbenzoic acid. InChIKey: GOWHUHLKBKFDKK-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO5S |
|---|---|
| Molecular weight | 305.74 g/mol |
| IUPAC name | 2-chloro-5-morpholin-4-ylsulfonylbenzoic acid |
| InChIKey | GOWHUHLKBKFDKK-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)