CAS 314245-35-7 appears in our catalog under these names: Dimethyl 5-[(chloroacetyl)amino]-3-methylthiophene-2,4-dicarboxylate, 95%, Dimethyl 5-(2-chloroacetamido)-3-methylthiophene-2,4-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Dimethyl 5-[(2-chloroacetyl)amino]-3-methylthiophene-2,4-dicarboxylate (CAS 314245-35-7) is a chemical compound with the molecular formula C11H12ClNO5S and a molecular weight of 305.74 g/mol. IUPAC name: dimethyl 5-[(2-chloroacetyl)amino]-3-methylthiophene-2,4-dicarboxylate. InChIKey: KCXXOKQRUUODQO-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO5S |
|---|---|
| Molecular weight | 305.74 g/mol |
| IUPAC name | dimethyl 5-[(2-chloroacetyl)amino]-3-methylthiophene-2,4-dicarboxylate |
| InChIKey | KCXXOKQRUUODQO-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)OC)NC(=O)CCl)C(=O)OC |
Computed by PubChem (NCBI)