CAS 109029-99-4 appears in our catalog under these names: 4-Chloro-3-((4-methoxyphenyl)sulfamoyl)benzoic acid, 4-Chloro-3-(4-methoxy-phenylsulfamoyl)-benzoic acid, 95%, 4-Chloro-3-((4-methoxyphenyl)sulfamoyl)benzoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 5g, 0,5g, 1g, 10g, 250mg, 100mg.
4-chloro-3-[(4-methoxyphenyl)sulfamoyl]benzoic acid (CAS 109029-99-4) is a chemical compound with the molecular formula C14H12ClNO5S and a molecular weight of 341.8 g/mol. IUPAC name: 4-chloro-3-[(4-methoxyphenyl)sulfamoyl]benzoic acid. InChIKey: DRZUKKVFQKGWOJ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO5S |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | 4-chloro-3-[(4-methoxyphenyl)sulfamoyl]benzoic acid |
| InChIKey | DRZUKKVFQKGWOJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NS(=O)(=O)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)