CAS 606945-28-2 appears in our catalog under these names: ((4–(2–Chlorophenoxy)phenyl)sulfonyl)glycine, ((4-(2-Chlorophenoxy)phenyl)sulfonyl)glycine, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg.
2-[[4-(2-chlorophenoxy)phenyl]sulfonylamino]acetic acid (CAS 606945-28-2) is a chemical compound with the molecular formula C14H12ClNO5S and a molecular weight of 341.8 g/mol. IUPAC name: 2-[[4-(2-chlorophenoxy)phenyl]sulfonylamino]acetic acid. InChIKey: OUJVPHDKPKCGPV-UHFFFAOYSA-N.
| Molecular formula | C14H12ClNO5S |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | 2-[[4-(2-chlorophenoxy)phenyl]sulfonylamino]acetic acid |
| InChIKey | OUJVPHDKPKCGPV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OC2=CC=C(C=C2)S(=O)(=O)NCC(=O)O)Cl |
Computed by PubChem (NCBI)