Products 1090361-16-2
CAS 1090361-16-2 is the registry number for 1-(4-acetylpiperazin-1-yl)-2-(4-nitrophenyl)ethan-1-one. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
1-(4-acetylpiperazin-1-yl)-2-(4-nitrophenyl)ethanone (CAS 1090361-16-2) is a chemical compound with the molecular formula C14H17N3O4 and a molecular weight of 291.30 g/mol. IUPAC name: 1-(4-acetylpiperazin-1-yl)-2-(4-nitrophenyl)ethanone. InChIKey: WMULZNDMBQZROG-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O4 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 1-(4-acetylpiperazin-1-yl)-2-(4-nitrophenyl)ethanone |
| InChIKey | WMULZNDMBQZROG-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)C(=O)CC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)