CAS 1090436-81-9 is the registry number for Methyl 3-(cyclopropanecarboxamido)-4-fluorobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(cyclopropanecarbonylamino)-4-fluorobenzoate (CAS 1090436-81-9) is a chemical compound with the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. IUPAC name: methyl 3-(cyclopropanecarbonylamino)-4-fluorobenzoate. InChIKey: DDXUEBUMKPHNNL-UHFFFAOYSA-N.
| Molecular formula | C12H12FNO3 |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | methyl 3-(cyclopropanecarbonylamino)-4-fluorobenzoate |
| InChIKey | DDXUEBUMKPHNNL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)NC(=O)C2CC2 |
Computed by PubChem (NCBI)