Products 346446-24-0

CAS 346446-24-0 is the registry number for 1-(2-Fluoro-5-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(2-fluoro-5-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 346446-24-0) is a chemical compound with the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. IUPAC name: 1-(2-fluoro-5-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: QSGKDHFXZIPZLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12FNO3
Molecular weight237.23 g/mol
IUPAC name1-(2-fluoro-5-methylphenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyQSGKDHFXZIPZLQ-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)F)N2CC(CC2=O)C(=O)O

Computed by PubChem (NCBI)